C42H41Cl2F3N4O5 — CID 86762260
SCHEMBL13452920 (PubChem CID 86762260) has the molecular formula C42H41Cl2F3N4O5 and a molecular weight of 809.71 g/mol.
| Compound Name | SCHEMBL13452920 |
|---|---|
| PubChem CID | 86762260 |
| Molecular Formula | C42H41Cl2F3N4O5 |
| Molecular Weight | 809.71 g/mol |
| Exact Mass | 808.24 |
| IUPAC Name | — |
| SMILES | O=C(N[C@@H]1CC[C@@H](CO)OC1)[C@H]1[C@H](c2ccnc(Cl)c2F)C2(C(=O)Nc3cc(Cl)ccc32)C2(CC(CF)(CF)C2)N1[C@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C42H41Cl2F3N4O5/c43-26-11-14-30-31(17-26)50-39(55)42(30)32(29-15-16-48-37(44)33(29)47)35(38(54)49-27-12-13-28(18-52)56-19-27)51(41(42)20-40(21-41,22-45)23-46)34(24-7-3-1-4-8-24)36(53)25-9-5-2-6-10-25/h1-11,14-17,27-28,32,34-36,52-53H,12-13,18-23H2,(H,49,54)(H,50,55)/t27-,28+,32+,34-,35-,36+,42?/m1/s1 |
| InChIKey | APMSHOPCXKABIN-GJPXQIOLSA-N |
| XLogP | 6.77 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|