C22H17ClFN9O — CID 86763204
Gs-9901 (PubChem CID 86763204) has the molecular formula C22H17ClFN9O and a molecular weight of 477.90 g/mol. Its IUPAC name is 2,4-diamino-6-[[(S)-(5-chloro-8-fluoro-4-oxo-3-pyridin-3-ylquinazolin-2-yl)-cyclopropylmethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | Gs-9901 |
|---|---|
| PubChem CID | 86763204 |
| Molecular Formula | C22H17ClFN9O |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 2,4-diamino-6-[[(S)-(5-chloro-8-fluoro-4-oxo-3-pyridin-3-ylquinazolin-2-yl)-cyclopropylmethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C1CC1[C@@H](C2=NC3=C(C=CC(=C3C(=O)N2C4=CN=CC=C4)Cl)F)NC5=NC(=NC(=C5C#N)N)N |
| InChI | InChI=1S/C22H17ClFN9O/c23-13-5-6-14(24)17-15(13)21(34)33(11-2-1-7-28-9-11)20(30-17)16(10-3-4-10)29-19-12(8-25)18(26)31-22(27)32-19/h1-2,5-7,9-10,16H,3-4H2,(H5,26,27,29,31,32)/t16-/m0/s1 |
| InChIKey | XDSXYMOZKDUASY-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | 863 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |