C22H18F3N7O — CID 86763299
3-[1-[(2,3-difluoro-4-methylphenyl)methyl]-5-fluoro-6-methylpyrazolo[3,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 86763299) has the molecular formula C22H18F3N7O and a molecular weight of 453.43 g/mol. Its IUPAC name is 3-[1-[(2,3-difluoro-4-methylphenyl)methyl]-5-fluoro-6-methylpyrazolo[3,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[1-[(2,3-difluoro-4-methylphenyl)methyl]-5-fluoro-6-methylpyrazolo[3,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 86763299 |
| Molecular Formula | C22H18F3N7O |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-[1-[(2,3-difluoro-4-methylphenyl)methyl]-5-fluoro-6-methylpyrazolo[3,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | Cc1ccc(Cn2nc(-c3nnc4c(n3)NC(=O)C4(C)C)c3cc(F)c(C)nc32)c(F)c1F |
| InChI | InChI=1S/C22H18F3N7O/c1-9-5-6-11(15(25)14(9)24)8-32-20-12(7-13(23)10(2)26-20)16(31-32)18-27-19-17(29-30-18)22(3,4)21(33)28-19/h5-7H,8H2,1-4H3,(H,27,28,30,33) |
| InChIKey | WGWCCZVXGDNGEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |