About 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone
2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone (PubChem CID 86763372) has the molecular formula C20H22F2N6O
and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone |
| PubChem CID | 86763372 |
| Molecular Formula | C20H22F2N6O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone |
| SMILES | CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(CC(=O)c3ccccn3)c2n1 |
| InChI | InChI=1S/C20H22F2N6O/c1-19(2,3)18-25-16(27-9-7-20(21,22)11-27)15-17(26-18)28(12-24-15)10-14(29)13-6-4-5-8-23-13/h4-6,8,12H,7,9-11H2,1-3H3 |
| InChIKey | ASZOUZRXODRYAG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone?
The IUPAC name of 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone (CID 86763372) is 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone.
What is the SMILES notation for 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone?
The canonical SMILES for 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone is CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(CC(=O)c3ccccn3)c2n1.
What is the InChIKey of 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone?
The InChIKey is ASZOUZRXODRYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N6O/c1-19(2,3)18-25-16(27-9-7-20(21,22)11-27)15-17(26-18)28(12-24-15)10-14(29)13-6-4-5-8-23-13/h4-6,8,12H,7,9-11H2,1-3H3.
What are the key properties of 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone?
2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone has a molecular weight of 400.43 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]-1-pyridin-2-ylethanone is sourced from PubChem (CID 86763372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).