About 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide
3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide (PubChem CID 86763484) has the molecular formula C16H21F2N5O2S
and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide |
| PubChem CID | 86763484 |
| Molecular Formula | C16H21F2N5O2S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide |
| SMILES | CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(C3CS(=O)(=O)C3)c2n1 |
| InChI | InChI=1S/C16H21F2N5O2S/c1-15(2,3)14-20-12(22-5-4-16(17,18)8-22)11-13(21-14)23(9-19-11)10-6-26(24,25)7-10/h9-10H,4-8H2,1-3H3 |
| InChIKey | ZEWSNEGMLVJXOL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide?
The IUPAC name of 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide (CID 86763484) is 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide.
What is the SMILES notation for 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide?
The canonical SMILES for 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide is CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(C3CS(=O)(=O)C3)c2n1.
What is the InChIKey of 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide?
The InChIKey is ZEWSNEGMLVJXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N5O2S/c1-15(2,3)14-20-12(22-5-4-16(17,18)8-22)11-13(21-14)23(9-19-11)10-6-26(24,25)7-10/h9-10H,4-8H2,1-3H3.
What are the key properties of 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide?
3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide has a molecular weight of 385.44 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)purin-9-yl]thietane 1,1-dioxide is sourced from PubChem (CID 86763484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).