C22H17N3O5S — CID 86763758
methyl 3-[(15-amino-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carbonyl)amino]benzoate (PubChem CID 86763758) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is methyl 3-[(15-amino-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(15-amino-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 86763758 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | methyl 3-[(15-amino-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2sc3nc4cc5c(cc4cc3c2N)OCCO5)c1 |
| InChI | InChI=1S/C22H17N3O5S/c1-28-22(27)11-3-2-4-13(7-11)24-20(26)19-18(23)14-8-12-9-16-17(30-6-5-29-16)10-15(12)25-21(14)31-19/h2-4,7-10H,5-6,23H2,1H3,(H,24,26) |
| InChIKey | IENKBTBTTYLLJD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |