C21H15N3O5S — CID 86763759
methyl 3-[(6-amino-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaene-5-carbonyl)amino]benzoate (PubChem CID 86763759) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is methyl 3-[(6-amino-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaene-5-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(6-amino-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaene-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 86763759 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | methyl 3-[(6-amino-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaene-5-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2sc3nc4cc5c(cc4cc3c2N)OCO5)c1 |
| InChI | InChI=1S/C21H15N3O5S/c1-27-21(26)10-3-2-4-12(5-10)23-19(25)18-17(22)13-6-11-7-15-16(29-9-28-15)8-14(11)24-20(13)30-18/h2-8H,9,22H2,1H3,(H,23,25) |
| InChIKey | KUGPPYYDKQKLSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |