C22H18N4O4S — CID 86763874
15-amino-N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide (PubChem CID 86763874) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 15-amino-N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide.
| Compound Name | 15-amino-N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 86763874 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 15-amino-N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide |
| SMILES | C/C(=N\O)c1cccc(NC(=O)c2sc3nc4cc5c(cc4cc3c2N)OCCO5)c1 |
| InChI | InChI=1S/C22H18N4O4S/c1-11(26-28)12-3-2-4-14(7-12)24-21(27)20-19(23)15-8-13-9-17-18(30-6-5-29-17)10-16(13)25-22(15)31-20/h2-4,7-10,28H,5-6,23H2,1H3,(H,24,27)/b26-11+ |
| InChIKey | NVJLZNJHAPDLHV-KBKYJPHKSA-N |
| XLogP | 4.25 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|