C38H49F3N6O3 — CID 86764505
(5Z,8Z,11Z,14Z,17Z)-N-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)-2-pyridinyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 86764505) has the molecular formula C38H49F3N6O3 and a molecular weight of 694.84 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)-2-pyridinyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)-2-pyridinyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 86764505 |
| Molecular Formula | C38H49F3N6O3 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.38 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)-2-pyridinyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Nc1cc(C(F)(F)F)c(-c2cc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C38H49F3N6O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-36(48)44-34-28-32(38(39,40)41)31(30-42-34)33-29-35(46-20-24-49-25-21-46)45-37(43-33)47-22-26-50-27-23-47/h3-4,6-7,9-10,12-13,15-16,28-30H,2,5,8,11,14,17-27H2,1H3,(H,42,44,48)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | NWMUFBOEHKZDBP-JLNKQSITSA-N |
| XLogP | 8.09 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|