C32H29N9O3S — CID 86764626
4-[6-amino-9-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-8-oxopurin-7-yl]-N-(1,3-benzothiazol-2-yl)benzamide (PubChem CID 86764626) has the molecular formula C32H29N9O3S and a molecular weight of 619.71 g/mol. Its IUPAC name is 4-[6-amino-9-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-8-oxopurin-7-yl]-N-(1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[6-amino-9-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-8-oxopurin-7-yl]-N-(1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86764626 |
| Molecular Formula | C32H29N9O3S |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 4-[6-amino-9-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-8-oxopurin-7-yl]-N-(1,3-benzothiazol-2-yl)benzamide |
| SMILES | CN(C)C/C=C/C(=O)N(C)c1cccc(-n2c(=O)n(-c3ccc(C(=O)Nc4nc5ccccc5s4)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C32H29N9O3S/c1-38(2)17-7-12-26(42)39(3)22-8-6-9-23(18-22)41-29-27(28(33)34-19-35-29)40(32(41)44)21-15-13-20(14-16-21)30(43)37-31-36-24-10-4-5-11-25(24)45-31/h4-16,18-19H,17H2,1-3H3,(H2,33,34,35)(H,36,37,43)/b12-7+ |
| InChIKey | VNJSHDLSCDPSJB-KPKJPENVSA-N |
| XLogP | 4.10 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|