About 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine (PubChem CID 86765033) has the molecular formula C21H25F2N5O2S
and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine |
| PubChem CID | 86765033 |
| Molecular Formula | C21H25F2N5O2S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine |
| SMILES | CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(Cc3ccccc3S(C)(=O)=O)c2n1 |
| InChI | InChI=1S/C21H25F2N5O2S/c1-20(2,3)19-25-17(27-10-9-21(22,23)12-27)16-18(26-19)28(13-24-16)11-14-7-5-6-8-15(14)31(4,29)30/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | RQIZGUXBXLQPJX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine?
The IUPAC name of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine (CID 86765033) is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine.
What is the SMILES notation for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine?
The canonical SMILES for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine is CC(C)(C)c1nc(N2CCC(F)(F)C2)c2ncn(Cc3ccccc3S(C)(=O)=O)c2n1.
What is the InChIKey of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine?
The InChIKey is RQIZGUXBXLQPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N5O2S/c1-20(2,3)19-25-17(27-10-9-21(22,23)12-27)16-18(26-19)28(13-24-16)11-14-7-5-6-8-15(14)31(4,29)30/h5-8,13H,9-12H2,1-4H3.
What are the key properties of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine?
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine has a molecular weight of 449.53 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(2-methylsulfonylphenyl)methyl]purine is sourced from PubChem (CID 86765033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).