C19H17NO5 — CID 86765296
6,10-dihydroxy-11-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one (PubChem CID 86765296) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 6,10-dihydroxy-11-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one.
| Compound Name | 6,10-dihydroxy-11-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 86765296 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6,10-dihydroxy-11-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES | COc1c(O)ccc2c(=O)c3c(O)cc4c(c3[nH]c12)C=CC(C)(C)O4 |
| InChI | InChI=1S/C19H17NO5/c1-19(2)7-6-9-13(25-19)8-12(22)14-15(9)20-16-10(17(14)23)4-5-11(21)18(16)24-3/h4-8,21-22H,1-3H3,(H,20,23) |
| InChIKey | COUZVMMRGYONAQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|