C29H41N9O4 — CID 86765434
1-[3-[[(3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(6-tert-butyl-1H-benzimidazol-2-yl)urea (PubChem CID 86765434) has the molecular formula C29H41N9O4 and a molecular weight of 579.71 g/mol. Its IUPAC name is 1-[3-[[(3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(6-tert-butyl-1H-benzimidazol-2-yl)urea.
| Compound Name | 1-[3-[[(3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(6-tert-butyl-1H-benzimidazol-2-yl)urea |
|---|---|
| PubChem CID | 86765434 |
| Molecular Formula | C29H41N9O4 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 1-[3-[[(3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(6-tert-butyl-1H-benzimidazol-2-yl)urea |
| SMILES | CC(C)N(CCCNC(=O)Nc1nc2ccc(C(C)(C)C)cc2[nH]1)CC1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H41N9O4/c1-16(2)37(14-21-22(39)23(40)26(42-21)38-12-9-18-24(30)32-15-33-25(18)38)11-6-10-31-28(41)36-27-34-19-8-7-17(29(3,4)5)13-20(19)35-27/h7-9,12-13,15-16,21-23,26,39-40H,6,10-11,14H2,1-5H3,(H2,30,32,33)(H3,31,34,35,36,41)/t21?,22-,23-,26-/m1/s1 |
| InChIKey | JHPZZWSSEJCBRJ-KYSCMSHESA-N |
| XLogP | 2.73 |
| TPSA | 179.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|