C23H20F2N4O4 — CID 86766014
2-(dimethylamino)ethyl (5Z)-2-(2,4-difluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate (PubChem CID 86766014) has the molecular formula C23H20F2N4O4 and a molecular weight of 454.43 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (5Z)-2-(2,4-difluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl (5Z)-2-(2,4-difluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 86766014 |
| Molecular Formula | C23H20F2N4O4 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-(dimethylamino)ethyl (5Z)-2-(2,4-difluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
| SMILES | CN(C)CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C23H20F2N4O4/c1-29(2)8-9-32-23(31)19-20(30)18(10-13-12-27-21-15(13)4-3-7-26-21)33-22(19)28-17-6-5-14(24)11-16(17)25/h3-7,10-12,19H,8-9H2,1-2H3,(H,26,27)/b18-10-,28-22- |
| InChIKey | YNVHEFKNVAUVCZ-NZERFMQLSA-N |
| XLogP | 3.23 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|