C19H20N4O5 — CID 86766018
ethyl (2Z,5Z)-2-morpholin-4-ylimino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate (PubChem CID 86766018) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl (2Z,5Z)-2-morpholin-4-ylimino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate.
| Compound Name | ethyl (2Z,5Z)-2-morpholin-4-ylimino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 86766018 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl (2Z,5Z)-2-morpholin-4-ylimino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\N1CCOCC1 |
| InChI | InChI=1S/C19H20N4O5/c1-2-27-19(25)15-16(24)14(28-18(15)22-23-6-8-26-9-7-23)10-12-11-21-17-13(12)4-3-5-20-17/h3-5,10-11,15H,2,6-9H2,1H3,(H,20,21)/b14-10-,22-18- |
| InChIKey | QLDWWBZKNUMKIN-DDJYZJNBSA-N |
| XLogP | 1.33 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|