C21H22F3N5O4 — CID 86766026
ethyl (2E,5Z)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]iminooxolane-3-carboxylate (PubChem CID 86766026) has the molecular formula C21H22F3N5O4 and a molecular weight of 465.43 g/mol. Its IUPAC name is ethyl (2E,5Z)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]iminooxolane-3-carboxylate.
| Compound Name | ethyl (2E,5Z)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]iminooxolane-3-carboxylate |
|---|---|
| PubChem CID | 86766026 |
| Molecular Formula | C21H22F3N5O4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | ethyl (2E,5Z)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]iminooxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N/N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C21H22F3N5O4/c1-2-32-20(31)16-17(30)15(10-13-11-26-18-14(13)4-3-5-25-18)33-19(16)27-29-8-6-28(7-9-29)12-21(22,23)24/h3-5,10-11,16H,2,6-9,12H2,1H3,(H,25,26)/b15-10-,27-19+ |
| InChIKey | BQHLDEGCOQGGPS-WUCCQEPQSA-N |
| XLogP | 2.18 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|