C21H26FN3O3 — CID 86766181
2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 86766181) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 86766181 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc2c(cc1OC)CN(CCNCC(=O)Nc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H26FN3O3/c1-27-19-11-15-7-9-25(14-16(15)12-20(19)28-2)10-8-23-13-21(26)24-18-5-3-17(22)4-6-18/h3-6,11-12,23H,7-10,13-14H2,1-2H3,(H,24,26) |
| InChIKey | HRFGVYWHQFHKKZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|