C21H25ClFN3O3 — CID 86766183
N-(3-chloro-4-fluorophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide (PubChem CID 86766183) has the molecular formula C21H25ClFN3O3 and a molecular weight of 421.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 86766183 |
| Molecular Formula | C21H25ClFN3O3 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide |
| SMILES | COc1cc2c(cc1OC)CN(CCNCC(=O)Nc1ccc(F)c(Cl)c1)CC2 |
| InChI | InChI=1S/C21H25ClFN3O3/c1-28-19-9-14-5-7-26(13-15(14)10-20(19)29-2)8-6-24-12-21(27)25-16-3-4-18(23)17(22)11-16/h3-4,9-11,24H,5-8,12-13H2,1-2H3,(H,25,27) |
| InChIKey | QZDFIIWCJMCROP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|