C22H26N4O3 — CID 86766184
N-(4-cyanophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide (PubChem CID 86766184) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 86766184 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(4-cyanophenyl)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]acetamide |
| SMILES | COc1cc2c(cc1OC)CN(CCNCC(=O)Nc1ccc(C#N)cc1)CC2 |
| InChI | InChI=1S/C22H26N4O3/c1-28-20-11-17-7-9-26(15-18(17)12-21(20)29-2)10-8-24-14-22(27)25-19-5-3-16(13-23)4-6-19/h3-6,11-12,24H,7-10,14-15H2,1-2H3,(H,25,27) |
| InChIKey | DZTJPOQXVAOCTL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|