C16H15F3N6 — CID 86766195
(3R)-1-([1,2,4]triazolo[4,3-a]pyrimidin-7-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine (PubChem CID 86766195) has the molecular formula C16H15F3N6 and a molecular weight of 348.33 g/mol. Its IUPAC name is (3R)-1-([1,2,4]triazolo[4,3-a]pyrimidin-7-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine.
| Compound Name | (3R)-1-([1,2,4]triazolo[4,3-a]pyrimidin-7-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 86766195 |
| Molecular Formula | C16H15F3N6 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3R)-1-([1,2,4]triazolo[4,3-a]pyrimidin-7-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
| SMILES | N[C@H]1CN(c2ccn3cnnc3n2)CCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H15F3N6/c17-11-6-13(19)12(18)5-10(11)9-1-3-24(7-14(9)20)15-2-4-25-8-21-23-16(25)22-15/h2,4-6,8-9,14H,1,3,7,20H2/t9?,14-/m0/s1 |
| InChIKey | BVGLFSCRZQKKNX-RJSPSEDBSA-N |
| XLogP | 1.86 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|