C29H26Cl2F5N5O3 — CID 86766331
2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,3,6-trifluorophenyl)benzimidazole-5-carboxamide (PubChem CID 86766331) has the molecular formula C29H26Cl2F5N5O3 and a molecular weight of 658.46 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,3,6-trifluorophenyl)benzimidazole-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,3,6-trifluorophenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 86766331 |
| Molecular Formula | C29H26Cl2F5N5O3 |
| Molecular Weight | 658.46 g/mol |
| Exact Mass | 657.13 |
| IUPAC Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,3,6-trifluorophenyl)benzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(C)(C)C)c2Cl)nc2cc(C(=O)Nc3c(F)ccc(F)c3F)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C29H26Cl2F5N5O3/c1-29(2,3)27(43)37-11-13-5-6-15(30)24(22(13)31)40-28-38-18-9-14(20(44-12-21(34)35)10-19(18)41(28)4)26(42)39-25-17(33)8-7-16(32)23(25)36/h5-10,21H,11-12H2,1-4H3,(H,37,43)(H,38,40)(H,39,42) |
| InChIKey | WDQZPBZSLKYYTA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.46 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|