About N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide
N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide (PubChem CID 86766408) has the molecular formula C19H16ClFN4O2S
and a molecular weight of 418.88 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide |
| PubChem CID | 86766408 |
| Molecular Formula | C19H16ClFN4O2S |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)N1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H16ClFN4O2S/c20-13-4-5-15-16(11-13)28-18(22-15)23-19(27)25-8-6-24(7-9-25)17(26)12-2-1-3-14(21)10-12/h1-5,10-11H,6-9H2,(H,22,23,27) |
| InChIKey | VQTQJTNJENBEND-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide?
The IUPAC name of N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide (CID 86766408) is N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide.
What is the SMILES notation for N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide?
The canonical SMILES for N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide is O=C(Nc1nc2ccc(Cl)cc2s1)N1CCN(C(=O)c2cccc(F)c2)CC1.
What is the InChIKey of N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide?
The InChIKey is VQTQJTNJENBEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFN4O2S/c20-13-4-5-15-16(11-13)28-18(22-15)23-19(27)25-8-6-24(7-9-25)17(26)12-2-1-3-14(21)10-12/h1-5,10-11H,6-9H2,(H,22,23,27).
What are the key properties of N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide?
N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide has a molecular weight of 418.88 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3-fluorobenzoyl)piperazine-1-carboxamide is sourced from PubChem (CID 86766408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).