C26H24N4O2 — CID 86766554
3-amino-1-methyl-3-[4-(5-phenyl-8-oxa-3,6,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-4-yl)phenyl]cyclobutan-1-ol (PubChem CID 86766554) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-amino-1-methyl-3-[4-(5-phenyl-8-oxa-3,6,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-4-yl)phenyl]cyclobutan-1-ol.
| Compound Name | 3-amino-1-methyl-3-[4-(5-phenyl-8-oxa-3,6,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-4-yl)phenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 86766554 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-amino-1-methyl-3-[4-(5-phenyl-8-oxa-3,6,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-4-yl)phenyl]cyclobutan-1-ol |
| SMILES | CC1(O)CC(N)(c2ccc(-c3nc4n(c3-c3ccccc3)COc3ncccc3-4)cc2)C1 |
| InChI | InChI=1S/C26H24N4O2/c1-25(31)14-26(27,15-25)19-11-9-17(10-12-19)21-22(18-6-3-2-4-7-18)30-16-32-24-20(23(30)29-21)8-5-13-28-24/h2-13,31H,14-16,27H2,1H3 |
| InChIKey | KJDKQSPIYGRKFY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |