C18H17F2N5O2 — CID 86766706
5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-methoxypyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 86766706) has the molecular formula C18H17F2N5O2 and a molecular weight of 373.36 g/mol. Its IUPAC name is 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-methoxypyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-methoxypyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 86766706 |
| Molecular Formula | C18H17F2N5O2 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-methoxypyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CONC(=O)c1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C18H17F2N5O2/c1-27-23-18(26)13-10-21-25-8-6-16(22-17(13)25)24-7-2-3-15(24)12-9-11(19)4-5-14(12)20/h4-6,8-10,15H,2-3,7H2,1H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | FUHAANUNQWUCBT-OAHLLOKOSA-N |
| XLogP | 2.64 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|