About N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide
N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide (PubChem CID 86766751) has the molecular formula C15H10BrFN4O2S
and a molecular weight of 409.24 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide.
Molecular Properties
| Compound Name | N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide |
| PubChem CID | 86766751 |
| Molecular Formula | C15H10BrFN4O2S |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide |
| SMILES | Cc1nc(NC(=O)c2cc(F)cc(Oc3cncnc3)c2)sc1Br |
| InChI | InChI=1S/C15H10BrFN4O2S/c1-8-13(16)24-15(20-8)21-14(22)9-2-10(17)4-11(3-9)23-12-5-18-7-19-6-12/h2-7H,1H3,(H,20,21,22) |
| InChIKey | YRZJRVLGAJFCTI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide?
The IUPAC name of N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide (CID 86766751) is N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide.
What is the SMILES notation for N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide?
The canonical SMILES for N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide is Cc1nc(NC(=O)c2cc(F)cc(Oc3cncnc3)c2)sc1Br.
What is the InChIKey of N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide?
The InChIKey is YRZJRVLGAJFCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrFN4O2S/c1-8-13(16)24-15(20-8)21-14(22)9-2-10(17)4-11(3-9)23-12-5-18-7-19-6-12/h2-7H,1H3,(H,20,21,22).
What are the key properties of N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide?
N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide has a molecular weight of 409.24 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-fluoro-5-pyrimidin-5-yloxybenzamide is sourced from PubChem (CID 86766751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).