C24H26F3N7O2 — CID 86766753
1-[3-[7-[(Z)-1-amino-4-imino-4-morpholin-4-ylbut-1-enyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 86766753) has the molecular formula C24H26F3N7O2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 1-[3-[7-[(Z)-1-amino-4-imino-4-morpholin-4-ylbut-1-enyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[(Z)-1-amino-4-imino-4-morpholin-4-ylbut-1-enyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 86766753 |
| Molecular Formula | C24H26F3N7O2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-[3-[7-[(Z)-1-amino-4-imino-4-morpholin-4-ylbut-1-enyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | [H]/N=C(/C/C=C(\N)c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1)N1CCOCC1 |
| InChI | InChI=1S/C24H26F3N7O2/c25-24(26,27)15-31-23(35)32-18-3-1-2-17(12-18)20-14-30-22-13-16(6-7-34(20)22)19(28)4-5-21(29)33-8-10-36-11-9-33/h1-4,6-7,12-14,29H,5,8-11,15,28H2,(H2,31,32,35)/b19-4-,29-21- |
| InChIKey | XEIJGSZLPPJMDB-WVZRWYNQSA-N |
| XLogP | 3.68 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|