C19H22N4OS — CID 86767139
1-(4-methoxyphenyl)-3-methylsulfanyl-6-piperazin-1-ylindazole (PubChem CID 86767139) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-methylsulfanyl-6-piperazin-1-ylindazole.
| Compound Name | 1-(4-methoxyphenyl)-3-methylsulfanyl-6-piperazin-1-ylindazole |
|---|---|
| PubChem CID | 86767139 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-methylsulfanyl-6-piperazin-1-ylindazole |
| SMILES | COc1ccc(-n2nc(SC)c3ccc(N4CCNCC4)cc32)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-24-16-6-3-14(4-7-16)23-18-13-15(22-11-9-20-10-12-22)5-8-17(18)19(21-23)25-2/h3-8,13,20H,9-12H2,1-2H3 |
| InChIKey | ZUYXSAJXSRKROC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |