C27H28F4N6O3 — CID 86767249
6-[2-(dimethylamino)ethyl]-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione (PubChem CID 86767249) has the molecular formula C27H28F4N6O3 and a molecular weight of 560.55 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethyl]-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethyl]-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione |
|---|---|
| PubChem CID | 86767249 |
| Molecular Formula | C27H28F4N6O3 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 6-[2-(dimethylamino)ethyl]-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione |
| SMILES | C[C@@H](Cc1c(F)c(F)cc(F)c1F)NC1CCNC(=O)C1c1nc2cc3c(cc2[nH]1)C(=O)N(CCN(C)C)C3=O |
| InChI | InChI=1S/C27H28F4N6O3/c1-12(8-15-22(30)16(28)11-17(29)23(15)31)33-18-4-5-32-25(38)21(18)24-34-19-9-13-14(10-20(19)35-24)27(40)37(26(13)39)7-6-36(2)3/h9-12,18,21,33H,4-8H2,1-3H3,(H,32,38)(H,34,35)/t12-,18?,21?/m0/s1 |
| InChIKey | ONFBJYHMZUOCOP-HWKNKJOVSA-N |
| XLogP | 2.47 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|