C28H24F4N6O3 — CID 86767253
5-hydroxy-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one (PubChem CID 86767253) has the molecular formula C28H24F4N6O3 and a molecular weight of 568.53 g/mol. Its IUPAC name is 5-hydroxy-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one.
| Compound Name | 5-hydroxy-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one |
|---|---|
| PubChem CID | 86767253 |
| Molecular Formula | C28H24F4N6O3 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 5-hydroxy-2-[2-oxo-4-[[(2S)-1-(2,3,5,6-tetrafluorophenyl)propan-2-yl]amino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one |
| SMILES | C[C@@H](Cc1c(F)c(F)cc(F)c1F)NC1CCNC(=O)C1c1nc2cc3c(cc2[nH]1)C(O)N(c1cccnc1)C3=O |
| InChI | InChI=1S/C28H24F4N6O3/c1-12(7-16-23(31)17(29)10-18(30)24(16)32)35-19-4-6-34-26(39)22(19)25-36-20-8-14-15(9-21(20)37-25)28(41)38(27(14)40)13-3-2-5-33-11-13/h2-3,5,8-12,19,22,27,35,40H,4,6-7H2,1H3,(H,34,39)(H,36,37)/t12-,19?,22?,27?/m0/s1 |
| InChIKey | TXVSBITXXISZJE-OMAPALIVSA-N |
| XLogP | 3.36 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|