C29H26F4N6O3 — CID 86767254
5-methoxy-2-[2-oxo-4-[1-(2,3,5,6-tetrafluorophenyl)propan-2-ylamino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one (PubChem CID 86767254) has the molecular formula C29H26F4N6O3 and a molecular weight of 582.56 g/mol. Its IUPAC name is 5-methoxy-2-[2-oxo-4-[1-(2,3,5,6-tetrafluorophenyl)propan-2-ylamino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one.
| Compound Name | 5-methoxy-2-[2-oxo-4-[1-(2,3,5,6-tetrafluorophenyl)propan-2-ylamino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one |
|---|---|
| PubChem CID | 86767254 |
| Molecular Formula | C29H26F4N6O3 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 5-methoxy-2-[2-oxo-4-[1-(2,3,5,6-tetrafluorophenyl)propan-2-ylamino]piperidin-3-yl]-6-pyridin-3-yl-3,5-dihydropyrrolo[3,4-f]benzimidazol-7-one |
| SMILES | COC1c2cc3[nH]c(C4C(=O)NCCC4NC(C)Cc4c(F)c(F)cc(F)c4F)nc3cc2C(=O)N1c1cccnc1 |
| InChI | InChI=1S/C29H26F4N6O3/c1-13(8-17-24(32)18(30)11-19(31)25(17)33)36-20-5-7-35-27(40)23(20)26-37-21-9-15-16(10-22(21)38-26)29(42-2)39(28(15)41)14-4-3-6-34-12-14/h3-4,6,9-13,20,23,29,36H,5,7-8H2,1-2H3,(H,35,40)(H,37,38) |
| InChIKey | CREZICZIIQMIJP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|