C12H21BrO — CID 86767328
(E)-5-(bromomethyl)-2,2,6,6-tetramethylhept-4-en-3-one (PubChem CID 86767328) has the molecular formula C12H21BrO and a molecular weight of 261.20 g/mol. Its IUPAC name is (E)-5-(bromomethyl)-2,2,6,6-tetramethylhept-4-en-3-one.
| Compound Name | (E)-5-(bromomethyl)-2,2,6,6-tetramethylhept-4-en-3-one |
|---|---|
| PubChem CID | 86767328 |
| Molecular Formula | C12H21BrO |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (E)-5-(bromomethyl)-2,2,6,6-tetramethylhept-4-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(/CBr)C(C)(C)C |
| InChI | InChI=1S/C12H21BrO/c1-11(2,3)9(8-13)7-10(14)12(4,5)6/h7H,8H2,1-6H3/b9-7- |
| InChIKey | ZTUSHYHWUWWBCU-CLFYSBASSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|