About (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride
(2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride (PubChem CID 86767497) has the molecular formula C7H17ClN2O
and a molecular weight of 180.68 g/mol. Its IUPAC name is (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride |
| PubChem CID | 86767497 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NC.Cl |
| InChI | InChI=1S/C7H16N2O.ClH/c1-4-5(2)6(8)7(10)9-3;/h5-6H,4,8H2,1-3H3,(H,9,10);1H/t5-,6-;/m0./s1 |
| InChIKey | AAVANSUHWBEDSU-GEMLJDPKSA-N |
| XLogP | 0.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride?
The IUPAC name of (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride (CID 86767497) is (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride.
What is the SMILES notation for (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride?
The canonical SMILES for (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride is CC[C@H](C)[C@H](N)C(=O)NC.Cl.
What is the InChIKey of (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride?
The InChIKey is AAVANSUHWBEDSU-GEMLJDPKSA-N. The full InChI is InChI=1S/C7H16N2O.ClH/c1-4-5(2)6(8)7(10)9-3;/h5-6H,4,8H2,1-3H3,(H,9,10);1H/t5-,6-;/m0./s1.
What are the key properties of (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride?
(2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride has a molecular weight of 180.68 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-N,3-dimethylpentanamide;hydrochloride is sourced from PubChem (CID 86767497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).