About 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride
2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride (PubChem CID 86767535) has the molecular formula C7H12Cl2N2S
and a molecular weight of 227.16 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride |
| PubChem CID | 86767535 |
| Molecular Formula | C7H12Cl2N2S |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride |
| SMILES | Cl.Cl.c1csc(C2CCCN2)n1 |
| InChI | InChI=1S/C7H10N2S.2ClH/c1-2-6(8-3-1)7-9-4-5-10-7;;/h4-6,8H,1-3H2;2*1H |
| InChIKey | GQYINDHFBHMDDN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride?
The IUPAC name of 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride (CID 86767535) is 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride?
The canonical SMILES for 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride is Cl.Cl.c1csc(C2CCCN2)n1.
What is the InChIKey of 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride?
The InChIKey is GQYINDHFBHMDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S.2ClH/c1-2-6(8-3-1)7-9-4-5-10-7;;/h4-6,8H,1-3H2;2*1H.
What are the key properties of 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride?
2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride has a molecular weight of 227.16 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-yl-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 86767535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).