About (E)-4-aminobut-2-enoic acid;hydrochloride
(E)-4-aminobut-2-enoic acid;hydrochloride (PubChem CID 86767669) has the molecular formula C4H8ClNO2
and a molecular weight of 137.57 g/mol. Its IUPAC name is (E)-4-aminobut-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (E)-4-aminobut-2-enoic acid;hydrochloride |
| PubChem CID | 86767669 |
| Molecular Formula | C4H8ClNO2 |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | (E)-4-aminobut-2-enoic acid;hydrochloride |
| SMILES | Cl.NC/C=C/C(=O)O |
| InChI | InChI=1S/C4H7NO2.ClH/c5-3-1-2-4(6)7;/h1-2H,3,5H2,(H,6,7);1H/b2-1+; |
| InChIKey | ASNDYIQICTUCOY-TYYBGVCCSA-N |
| XLogP | 0.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-aminobut-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-aminobut-2-enoic acid;hydrochloride?
The IUPAC name of (E)-4-aminobut-2-enoic acid;hydrochloride (CID 86767669) is (E)-4-aminobut-2-enoic acid;hydrochloride.
What is the SMILES notation for (E)-4-aminobut-2-enoic acid;hydrochloride?
The canonical SMILES for (E)-4-aminobut-2-enoic acid;hydrochloride is Cl.NC/C=C/C(=O)O.
What is the InChIKey of (E)-4-aminobut-2-enoic acid;hydrochloride?
The InChIKey is ASNDYIQICTUCOY-TYYBGVCCSA-N. The full InChI is InChI=1S/C4H7NO2.ClH/c5-3-1-2-4(6)7;/h1-2H,3,5H2,(H,6,7);1H/b2-1+;.
What are the key properties of (E)-4-aminobut-2-enoic acid;hydrochloride?
(E)-4-aminobut-2-enoic acid;hydrochloride has a molecular weight of 137.57 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-aminobut-2-enoic acid;hydrochloride is sourced from PubChem (CID 86767669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).