C13H18N2O2S — CID 8676777
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-ethyl-1-methylthiourea (PubChem CID 8676777) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-ethyl-1-methylthiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-ethyl-1-methylthiourea |
|---|---|
| PubChem CID | 8676777 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-ethyl-1-methylthiourea |
| SMILES | CCNC(=S)N(C)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-14-13(18)15(2)9-10-4-5-11-12(8-10)17-7-6-16-11/h4-5,8H,3,6-7,9H2,1-2H3,(H,14,18) |
| InChIKey | TWKCPMFCDHJEOX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|