About 3-bromo-5-fluoroimidazo[1,2-a]pyridine
3-bromo-5-fluoroimidazo[1,2-a]pyridine (PubChem CID 86767811) has the molecular formula C7H4BrFN2
and a molecular weight of 215.03 g/mol. Its IUPAC name is 3-bromo-5-fluoroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-bromo-5-fluoroimidazo[1,2-a]pyridine |
|---|
| PubChem CID | 86767811 |
|---|
| Molecular Formula | C7H4BrFN2 |
|---|
| Molecular Weight | 215.03 g/mol |
|---|
| Exact Mass | 213.95 |
|---|
| IUPAC Name | 3-bromo-5-fluoroimidazo[1,2-a]pyridine |
|---|
| SMILES | Fc1cccc2ncc(Br)n12 |
|---|
| InChI | InChI=1S/C7H4BrFN2/c8-5-4-10-7-3-1-2-6(9)11(5)7/h1-4H |
|---|
| InChIKey | SFPXYASSBWQZCS-UHFFFAOYSA-N |
|---|
| XLogP | 2.24 |
|---|
| TPSA | 17.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 215.03 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-fluoroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-fluoroimidazo[1,2-a]pyridine?
The IUPAC name of 3-bromo-5-fluoroimidazo[1,2-a]pyridine (CID 86767811) is 3-bromo-5-fluoroimidazo[1,2-a]pyridine.
What is the SMILES notation for 3-bromo-5-fluoroimidazo[1,2-a]pyridine?
The canonical SMILES for 3-bromo-5-fluoroimidazo[1,2-a]pyridine is Fc1cccc2ncc(Br)n12.
What is the InChIKey of 3-bromo-5-fluoroimidazo[1,2-a]pyridine?
The InChIKey is SFPXYASSBWQZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFN2/c8-5-4-10-7-3-1-2-6(9)11(5)7/h1-4H.
What are the key properties of 3-bromo-5-fluoroimidazo[1,2-a]pyridine?
3-bromo-5-fluoroimidazo[1,2-a]pyridine has a molecular weight of 215.03 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-fluoroimidazo[1,2-a]pyridine is sourced from PubChem (CID 86767811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).