C13H15F3N2O2 — CID 86768745
6-methyl-3-[3-(trifluoromethyl)piperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 86768745) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 6-methyl-3-[3-(trifluoromethyl)piperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-methyl-3-[3-(trifluoromethyl)piperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 86768745 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-methyl-3-[3-(trifluoromethyl)piperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(F)(F)F)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15F3N2O2/c1-8-4-5-10(11(19)17-8)12(20)18-6-2-3-9(7-18)13(14,15)16/h4-5,9H,2-3,6-7H2,1H3,(H,17,19) |
| InChIKey | PTGMVHMIPVSOGX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |