C17H24N2O2 — CID 86768780
6-methyl-3-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one (PubChem CID 86768780) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 6-methyl-3-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-methyl-3-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 86768780 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-methyl-3-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one |
| SMILES | Cc1ccc(C(=O)N2CCC(C)C3CCCCC32)c(=O)[nH]1 |
| InChI | InChI=1S/C17H24N2O2/c1-11-9-10-19(15-6-4-3-5-13(11)15)17(21)14-8-7-12(2)18-16(14)20/h7-8,11,13,15H,3-6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | NKMRZJKYWZUZCB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |