C14H16N2O — CID 86768829
3-methyl-N-prop-2-ynyl-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 86768829) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-methyl-N-prop-2-ynyl-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 3-methyl-N-prop-2-ynyl-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 86768829 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-methyl-N-prop-2-ynyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | C#CCNC(=O)N1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C14H16N2O/c1-3-8-15-14(17)16-10-11(2)9-12-6-4-5-7-13(12)16/h1,4-7,11H,8-10H2,2H3,(H,15,17) |
| InChIKey | CKEXAPBHZBJBOO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|