C16H24N4O — CID 86769571
4-(2-tert-butylpyrimidin-4-yl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 86769571) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-(2-tert-butylpyrimidin-4-yl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | 4-(2-tert-butylpyrimidin-4-yl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 86769571 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-(2-tert-butylpyrimidin-4-yl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | CC(C)(C)c1nccc(N2CC(=O)NC3CCCCC32)n1 |
| InChI | InChI=1S/C16H24N4O/c1-16(2,3)15-17-9-8-13(19-15)20-10-14(21)18-11-6-4-5-7-12(11)20/h8-9,11-12H,4-7,10H2,1-3H3,(H,18,21) |
| InChIKey | IYRUHJOOMQLCJN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |