C12H16BrN3O — CID 86769592
N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-5-bromopyrimidin-2-amine (PubChem CID 86769592) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-5-bromopyrimidin-2-amine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-5-bromopyrimidin-2-amine |
|---|---|
| PubChem CID | 86769592 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-5-bromopyrimidin-2-amine |
| SMILES | Brc1cnc(NC2CCCC3OCCC23)nc1 |
| InChI | InChI=1S/C12H16BrN3O/c13-8-6-14-12(15-7-8)16-10-2-1-3-11-9(10)4-5-17-11/h6-7,9-11H,1-5H2,(H,14,15,16) |
| InChIKey | PPWQOBLIFHJFDV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |