About 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine]
4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] (PubChem CID 86769734) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine].
Molecular Properties
| Compound Name | 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
| PubChem CID | 86769734 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
| SMILES | c1ccc2c(c1)CCC21CN(CCc2ccncc2)CCO1 |
| InChI | InChI=1S/C19H22N2O/c1-2-4-18-17(3-1)5-9-19(18)15-21(13-14-22-19)12-8-16-6-10-20-11-7-16/h1-4,6-7,10-11H,5,8-9,12-15H2 |
| InChIKey | OMVAFHZNALVFRJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The IUPAC name of 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] (CID 86769734) is 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine].
What is the SMILES notation for 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The canonical SMILES for 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] is c1ccc2c(c1)CCC21CN(CCc2ccncc2)CCO1.
What is the InChIKey of 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The InChIKey is OMVAFHZNALVFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-2-4-18-17(3-1)5-9-19(18)15-21(13-14-22-19)12-8-16-6-10-20-11-7-16/h1-4,6-7,10-11H,5,8-9,12-15H2.
What are the key properties of 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] has a molecular weight of 294.40 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(2-pyridin-4-ylethyl)spiro[1,2-dihydroindene-3,2'-morpholine] is sourced from PubChem (CID 86769734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).