C19H28N4O4 — CID 86770821
(4R,8R)-N-(2-methoxyethyl)-1-methyl-2-oxo-8-(pyridine-3-carbonylamino)azonane-4-carboxamide (PubChem CID 86770821) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (4R,8R)-N-(2-methoxyethyl)-1-methyl-2-oxo-8-(pyridine-3-carbonylamino)azonane-4-carboxamide.
| Compound Name | (4R,8R)-N-(2-methoxyethyl)-1-methyl-2-oxo-8-(pyridine-3-carbonylamino)azonane-4-carboxamide |
|---|---|
| PubChem CID | 86770821 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (4R,8R)-N-(2-methoxyethyl)-1-methyl-2-oxo-8-(pyridine-3-carbonylamino)azonane-4-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCC[C@@H](NC(=O)c2cccnc2)CN(C)C(=O)C1 |
| InChI | InChI=1S/C19H28N4O4/c1-23-13-16(22-19(26)15-6-4-8-20-12-15)7-3-5-14(11-17(23)24)18(25)21-9-10-27-2/h4,6,8,12,14,16H,3,5,7,9-11,13H2,1-2H3,(H,21,25)(H,22,26)/t14-,16-/m1/s1 |
| InChIKey | HPBMAESUNBLLJX-GDBMZVCRSA-N |
| XLogP | 0.59 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|