C18H21FN4O2 — CID 86770951
1-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-3-[1-(2-fluorophenyl)pyrazol-4-yl]urea (PubChem CID 86770951) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-3-[1-(2-fluorophenyl)pyrazol-4-yl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-3-[1-(2-fluorophenyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 86770951 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-3-[1-(2-fluorophenyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(-c2ccccc2F)c1)NC1CCCC2OCCC12 |
| InChI | InChI=1S/C18H21FN4O2/c19-14-4-1-2-6-16(14)23-11-12(10-20-23)21-18(24)22-15-5-3-7-17-13(15)8-9-25-17/h1-2,4,6,10-11,13,15,17H,3,5,7-9H2,(H2,21,22,24) |
| InChIKey | NAHJCDYGJFOUHX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |