About N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine
N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine (PubChem CID 86771267) has the molecular formula C21H23F2NO4S
and a molecular weight of 423.48 g/mol. Its IUPAC name is N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine.
Molecular Properties
| Compound Name | N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine |
| PubChem CID | 86771267 |
| Molecular Formula | C21H23F2NO4S |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine |
| SMILES | O=S1(=O)CCC2(CC(NCc3ccc(Oc4cc(F)cc(F)c4)cc3)CCO2)C1 |
| InChI | InChI=1S/C21H23F2NO4S/c22-16-9-17(23)11-20(10-16)28-19-3-1-15(2-4-19)13-24-18-5-7-27-21(12-18)6-8-29(25,26)14-21/h1-4,9-11,18,24H,5-8,12-14H2 |
| InChIKey | HUVCSEQOPXJLRC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine?
The IUPAC name of N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine (CID 86771267) is N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine.
What is the SMILES notation for N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine?
The canonical SMILES for N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine is O=S1(=O)CCC2(CC(NCc3ccc(Oc4cc(F)cc(F)c4)cc3)CCO2)C1.
What is the InChIKey of N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine?
The InChIKey is HUVCSEQOPXJLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2NO4S/c22-16-9-17(23)11-20(10-16)28-19-3-1-15(2-4-19)13-24-18-5-7-27-21(12-18)6-8-29(25,26)14-21/h1-4,9-11,18,24H,5-8,12-14H2.
What are the key properties of N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine?
N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine has a molecular weight of 423.48 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine is sourced from PubChem (CID 86771267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).