C15H20N4O4S — CID 86771315
N-[6-(2-methoxyethoxy)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide (PubChem CID 86771315) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide.
| Compound Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 86771315 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
| SMILES | COCCOc1ccc(NS(=O)(=O)c2cn3c(n2)CCCC3)cn1 |
| InChI | InChI=1S/C15H20N4O4S/c1-22-8-9-23-14-6-5-12(10-16-14)18-24(20,21)15-11-19-7-3-2-4-13(19)17-15/h5-6,10-11,18H,2-4,7-9H2,1H3 |
| InChIKey | AEBVGBLZQBFRKD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|