C23H25N3O2 — CID 86771857
(2S,3S,8R)-1'-methyl-N-(4-methylphenyl)-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide (PubChem CID 86771857) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S,3S,8R)-1'-methyl-N-(4-methylphenyl)-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide.
| Compound Name | (2S,3S,8R)-1'-methyl-N-(4-methylphenyl)-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
|---|---|
| PubChem CID | 86771857 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2S,3S,8R)-1'-methyl-N-(4-methylphenyl)-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2C[C@H]3CCCN3[C@@]23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-15-9-11-16(12-10-15)24-21(27)19-14-17-6-5-13-26(17)23(19)18-7-3-4-8-20(18)25(2)22(23)28/h3-4,7-12,17,19H,5-6,13-14H2,1-2H3,(H,24,27)/t17-,19-,23-/m1/s1 |
| InChIKey | XNNXNVWDVGSRNN-LYHRCORUSA-N |
| XLogP | 3.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |