C15H20N4O2S — CID 86771959
7a-methyl-5-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 86771959) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 7a-methyl-5-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-5-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 86771959 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 7a-methyl-5-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)NC1CCc3nccn3C1)CS2 |
| InChI | InChI=1S/C15H20N4O2S/c1-15-5-4-13(20)19(15)11(9-22-15)14(21)17-10-2-3-12-16-6-7-18(12)8-10/h6-7,10-11H,2-5,8-9H2,1H3,(H,17,21) |
| InChIKey | SOGIEMALIOTPKM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |