C18H23N3O2 — CID 86772130
4-(2-methylphenoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)butanamide (PubChem CID 86772130) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)butanamide.
| Compound Name | 4-(2-methylphenoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)butanamide |
|---|---|
| PubChem CID | 86772130 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-(2-methylphenoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NC1CCc2nccn2C1 |
| InChI | InChI=1S/C18H23N3O2/c1-14-5-2-3-6-16(14)23-12-4-7-18(22)20-15-8-9-17-19-10-11-21(17)13-15/h2-3,5-6,10-11,15H,4,7-9,12-13H2,1H3,(H,20,22) |
| InChIKey | SQQYGURDNATOLN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|