C17H18N6O — CID 86772269
N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-phenylimidazole-4-carboxamide (PubChem CID 86772269) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-phenylimidazole-4-carboxamide.
| Compound Name | N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 86772269 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-phenylimidazole-4-carboxamide |
| SMILES | Cc1nnc2n1CC(NC(=O)c1cncn1-c1ccccc1)CC2 |
| InChI | InChI=1S/C17H18N6O/c1-12-20-21-16-8-7-13(10-22(12)16)19-17(24)15-9-18-11-23(15)14-5-3-2-4-6-14/h2-6,9,11,13H,7-8,10H2,1H3,(H,19,24) |
| InChIKey | MHUOBSDYJITVBL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |